About 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride
2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride (PubChem CID 56777519) has the molecular formula C8H10ClN3O
and a molecular weight of 199.64 g/mol. Its IUPAC name is 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride |
| PubChem CID | 56777519 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride |
| SMILES | Cl.Nc1ncc2c(n1)CCCC2=O |
| InChI | InChI=1S/C8H9N3O.ClH/c9-8-10-4-5-6(11-8)2-1-3-7(5)12;/h4H,1-3H2,(H2,9,10,11);1H |
| InChIKey | DZLPJUAUGVLQIK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride?
The IUPAC name of 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride (CID 56777519) is 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride.
What is the SMILES notation for 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride?
The canonical SMILES for 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride is Cl.Nc1ncc2c(n1)CCCC2=O.
What is the InChIKey of 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride?
The InChIKey is DZLPJUAUGVLQIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O.ClH/c9-8-10-4-5-6(11-8)2-1-3-7(5)12;/h4H,1-3H2,(H2,9,10,11);1H.
What are the key properties of 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride?
2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride has a molecular weight of 199.64 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,8-dihydro-6H-quinazolin-5-one;hydrochloride is sourced from PubChem (CID 56777519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).