About 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine
7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine (PubChem CID 56777988) has the molecular formula C12H10F3N5
and a molecular weight of 281.24 g/mol. Its IUPAC name is 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
| PubChem CID | 56777988 |
| Molecular Formula | C12H10F3N5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
| SMILES | FC(F)(F)c1ccnc(N2CCc3cncnc3C2)n1 |
| InChI | InChI=1S/C12H10F3N5/c13-12(14,15)10-1-3-17-11(19-10)20-4-2-8-5-16-7-18-9(8)6-20/h1,3,5,7H,2,4,6H2 |
| InChIKey | ZIYZOOKBZUVONF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine?
The IUPAC name of 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine (CID 56777988) is 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine.
What is the SMILES notation for 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine?
The canonical SMILES for 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine is FC(F)(F)c1ccnc(N2CCc3cncnc3C2)n1.
What is the InChIKey of 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine?
The InChIKey is ZIYZOOKBZUVONF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N5/c13-12(14,15)10-1-3-17-11(19-10)20-4-2-8-5-16-7-18-9(8)6-20/h1,3,5,7H,2,4,6H2.
What are the key properties of 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine?
7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine has a molecular weight of 281.24 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-(trifluoromethyl)pyrimidin-2-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine is sourced from PubChem (CID 56777988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).