C16H20N6O — CID 56778576
(5-methylpyrazin-2-yl)-[4-[(6-methylpyridazin-3-yl)amino]piperidin-1-yl]methanone (PubChem CID 56778576) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl)-[4-[(6-methylpyridazin-3-yl)amino]piperidin-1-yl]methanone.
| Compound Name | (5-methylpyrazin-2-yl)-[4-[(6-methylpyridazin-3-yl)amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56778576 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (5-methylpyrazin-2-yl)-[4-[(6-methylpyridazin-3-yl)amino]piperidin-1-yl]methanone |
| SMILES | Cc1cnc(C(=O)N2CCC(Nc3ccc(C)nn3)CC2)cn1 |
| InChI | InChI=1S/C16H20N6O/c1-11-3-4-15(21-20-11)19-13-5-7-22(8-6-13)16(23)14-10-17-12(2)9-18-14/h3-4,9-10,13H,5-8H2,1-2H3,(H,19,21) |
| InChIKey | ILGAKSYEAVVANT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |