About imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone
imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone (PubChem CID 56779088) has the molecular formula C17H20N6O
and a molecular weight of 324.39 g/mol. Its IUPAC name is imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone |
| PubChem CID | 56779088 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone |
| SMILES | Cc1cnn(CC2CCCCN2C(=O)c2cn3cccnc3n2)c1 |
| InChI | InChI=1S/C17H20N6O/c1-13-9-19-22(10-13)11-14-5-2-3-8-23(14)16(24)15-12-21-7-4-6-18-17(21)20-15/h4,6-7,9-10,12,14H,2-3,5,8,11H2,1H3 |
| InChIKey | OVCFOVXOZOLRHH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone?
The IUPAC name of imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone (CID 56779088) is imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone.
What is the SMILES notation for imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone?
The canonical SMILES for imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone is Cc1cnn(CC2CCCCN2C(=O)c2cn3cccnc3n2)c1.
What is the InChIKey of imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone?
The InChIKey is OVCFOVXOZOLRHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N6O/c1-13-9-19-22(10-13)11-14-5-2-3-8-23(14)16(24)15-12-21-7-4-6-18-17(21)20-15/h4,6-7,9-10,12,14H,2-3,5,8,11H2,1H3.
What are the key properties of imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone?
imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone has a molecular weight of 324.39 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyrimidin-2-yl-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone is sourced from PubChem (CID 56779088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).