About [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone
[2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone (PubChem CID 56779115) has the molecular formula C16H22N4O2S
and a molecular weight of 334.45 g/mol. Its IUPAC name is [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone |
| PubChem CID | 56779115 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone |
| SMILES | COCc1nc(C(=O)N2CCCCC2Cn2cc(C)cn2)cs1 |
| InChI | InChI=1S/C16H22N4O2S/c1-12-7-17-19(8-12)9-13-5-3-4-6-20(13)16(21)14-11-23-15(18-14)10-22-2/h7-8,11,13H,3-6,9-10H2,1-2H3 |
| InChIKey | OIKSHHKIBXWYPZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone?
The IUPAC name of [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone (CID 56779115) is [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone.
What is the SMILES notation for [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone?
The canonical SMILES for [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone is COCc1nc(C(=O)N2CCCCC2Cn2cc(C)cn2)cs1.
What is the InChIKey of [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone?
The InChIKey is OIKSHHKIBXWYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O2S/c1-12-7-17-19(8-12)9-13-5-3-4-6-20(13)16(21)14-11-23-15(18-14)10-22-2/h7-8,11,13H,3-6,9-10H2,1-2H3.
What are the key properties of [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone?
[2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone has a molecular weight of 334.45 g/mol, XLogP of 2.49, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methoxymethyl)-1,3-thiazol-4-yl]-[2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]methanone is sourced from PubChem (CID 56779115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).