About [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone
[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone (PubChem CID 56779535) has the molecular formula C18H21N5O
and a molecular weight of 323.40 g/mol. Its IUPAC name is [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone.
Molecular Properties
| Compound Name | [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone |
| PubChem CID | 56779535 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone |
| SMILES | Cc1cc(C)n(CC2CCCN2C(=O)c2cccc3[nH]ncc23)n1 |
| InChI | InChI=1S/C18H21N5O/c1-12-9-13(2)23(21-12)11-14-5-4-8-22(14)18(24)15-6-3-7-17-16(15)10-19-20-17/h3,6-7,9-10,14H,4-5,8,11H2,1-2H3,(H,19,20) |
| InChIKey | SRJVXUBUOHRTKM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone?
The IUPAC name of [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone (CID 56779535) is [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone.
What is the SMILES notation for [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone?
The canonical SMILES for [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone is Cc1cc(C)n(CC2CCCN2C(=O)c2cccc3[nH]ncc23)n1.
What is the InChIKey of [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone?
The InChIKey is SRJVXUBUOHRTKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5O/c1-12-9-13(2)23(21-12)11-14-5-4-8-22(14)18(24)15-6-3-7-17-16(15)10-19-20-17/h3,6-7,9-10,14H,4-5,8,11H2,1-2H3,(H,19,20).
What are the key properties of [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone?
[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone has a molecular weight of 323.40 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-(1H-indazol-4-yl)methanone is sourced from PubChem (CID 56779535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).