About 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone
1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone (PubChem CID 56779791) has the molecular formula C16H22N4OS
and a molecular weight of 318.45 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
| PubChem CID | 56779791 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
| SMILES | Cc1cc(C)n(C2CCCN(C(=O)Cc3csc(C)n3)C2)n1 |
| InChI | InChI=1S/C16H22N4OS/c1-11-7-12(2)20(18-11)15-5-4-6-19(9-15)16(21)8-14-10-22-13(3)17-14/h7,10,15H,4-6,8-9H2,1-3H3 |
| InChIKey | DJDNTGMZTLZJEL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone?
The IUPAC name of 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone (CID 56779791) is 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone.
What is the SMILES notation for 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone?
The canonical SMILES for 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone is Cc1cc(C)n(C2CCCN(C(=O)Cc3csc(C)n3)C2)n1.
What is the InChIKey of 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone?
The InChIKey is DJDNTGMZTLZJEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4OS/c1-11-7-12(2)20(18-11)15-5-4-6-19(9-15)16(21)8-14-10-22-13(3)17-14/h7,10,15H,4-6,8-9H2,1-3H3.
What are the key properties of 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone?
1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone has a molecular weight of 318.45 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,5-dimethylpyrazol-1-yl)piperidin-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone is sourced from PubChem (CID 56779791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).