About 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one
6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one (PubChem CID 56779796) has the molecular formula C16H23N5O2
and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one |
| PubChem CID | 56779796 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one |
| SMILES | Cc1cc(C)n(C2CCCN(C(=O)C3=NN(C)C(=O)CC3)C2)n1 |
| InChI | InChI=1S/C16H23N5O2/c1-11-9-12(2)21(17-11)13-5-4-8-20(10-13)16(23)14-6-7-15(22)19(3)18-14/h9,13H,4-8,10H2,1-3H3 |
| InChIKey | KXLTZFKJVICKIB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
The IUPAC name of 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one (CID 56779796) is 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
The canonical SMILES for 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one is Cc1cc(C)n(C2CCCN(C(=O)C3=NN(C)C(=O)CC3)C2)n1.
What is the InChIKey of 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
The InChIKey is KXLTZFKJVICKIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O2/c1-11-9-12(2)21(17-11)13-5-4-8-20(10-13)16(23)14-6-7-15(22)19(3)18-14/h9,13H,4-8,10H2,1-3H3.
What are the key properties of 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one?
6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one has a molecular weight of 317.39 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(3,5-dimethylpyrazol-1-yl)piperidine-1-carbonyl]-2-methyl-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 56779796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).