C19H31N5O — CID 56780056
N-[2-(cyclohexen-1-yl)ethyl]-2-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]acetamide (PubChem CID 56780056) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 56780056 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]acetamide |
| SMILES | CC(C)c1nc2n(n1)CC(NCC(=O)NCCC1=CCCCC1)CC2 |
| InChI | InChI=1S/C19H31N5O/c1-14(2)19-22-17-9-8-16(13-24(17)23-19)21-12-18(25)20-11-10-15-6-4-3-5-7-15/h6,14,16,21H,3-5,7-13H2,1-2H3,(H,20,25) |
| InChIKey | VZVRFNUCEHETEC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|