About 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole
4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole (PubChem CID 56780360) has the molecular formula C15H22N4S
and a molecular weight of 290.44 g/mol. Its IUPAC name is 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole |
| PubChem CID | 56780360 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole |
| SMILES | Cc1cc(C)n(CC2CCCCN2Cc2cscn2)n1 |
| InChI | InChI=1S/C15H22N4S/c1-12-7-13(2)19(17-12)9-15-5-3-4-6-18(15)8-14-10-20-11-16-14/h7,10-11,15H,3-6,8-9H2,1-2H3 |
| InChIKey | SFHHAFCYVWVXHB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole?
The IUPAC name of 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole (CID 56780360) is 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole.
What is the SMILES notation for 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole?
The canonical SMILES for 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole is Cc1cc(C)n(CC2CCCCN2Cc2cscn2)n1.
What is the InChIKey of 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole?
The InChIKey is SFHHAFCYVWVXHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4S/c1-12-7-13(2)19(17-12)9-15-5-3-4-6-18(15)8-14-10-20-11-16-14/h7,10-11,15H,3-6,8-9H2,1-2H3.
What are the key properties of 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole?
4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole has a molecular weight of 290.44 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]methyl]-1,3-thiazole is sourced from PubChem (CID 56780360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).