About 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole
6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 56780532) has the molecular formula C15H19N5S
and a molecular weight of 301.42 g/mol. Its IUPAC name is 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole |
| PubChem CID | 56780532 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1cnn(CC2CCCN2Cc2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C15H19N5S/c1-12-7-16-20(8-12)11-14-3-2-4-18(14)9-13-10-19-5-6-21-15(19)17-13/h5-8,10,14H,2-4,9,11H2,1H3 |
| InChIKey | RDBLQZSOSNGNDK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole (CID 56780532) is 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole is Cc1cnn(CC2CCCN2Cc2cn3ccsc3n2)c1.
What is the InChIKey of 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole?
The InChIKey is RDBLQZSOSNGNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5S/c1-12-7-16-20(8-12)11-14-3-2-4-18(14)9-13-10-19-5-6-21-15(19)17-13/h5-8,10,14H,2-4,9,11H2,1H3.
What are the key properties of 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole?
6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole has a molecular weight of 301.42 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 56780532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).