About 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole
4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole (PubChem CID 56780686) has the molecular formula C18H25N3O2S
and a molecular weight of 347.48 g/mol. Its IUPAC name is 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole.
Molecular Properties
| Compound Name | 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole |
| PubChem CID | 56780686 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1C1CCCN1CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H25N3O2S/c1-14-18(15(2)20(3)19-14)17-10-7-11-21(17)12-13-24(22,23)16-8-5-4-6-9-16/h4-6,8-9,17H,7,10-13H2,1-3H3 |
| InChIKey | JVKXLGCOYVMWOM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole?
The IUPAC name of 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole (CID 56780686) is 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole.
What is the SMILES notation for 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole?
The canonical SMILES for 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole is Cc1nn(C)c(C)c1C1CCCN1CCS(=O)(=O)c1ccccc1.
What is the InChIKey of 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole?
The InChIKey is JVKXLGCOYVMWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O2S/c1-14-18(15(2)20(3)19-14)17-10-7-11-21(17)12-13-24(22,23)16-8-5-4-6-9-16/h4-6,8-9,17H,7,10-13H2,1-3H3.
What are the key properties of 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole?
4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole has a molecular weight of 347.48 g/mol, XLogP of 2.65, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[2-(benzenesulfonyl)ethyl]pyrrolidin-2-yl]-1,3,5-trimethylpyrazole is sourced from PubChem (CID 56780686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).