About 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol
1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol (PubChem CID 56780851) has the molecular formula C17H29N3O
and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol |
| PubChem CID | 56780851 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol |
| SMILES | Cc1cc(C)n(CC2CCCN2CC2(O)CCCCC2)n1 |
| InChI | InChI=1S/C17H29N3O/c1-14-11-15(2)20(18-14)12-16-7-6-10-19(16)13-17(21)8-4-3-5-9-17/h11,16,21H,3-10,12-13H2,1-2H3 |
| InChIKey | XTVJCVGFMGHEIW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol?
The IUPAC name of 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol (CID 56780851) is 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol?
The canonical SMILES for 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol is Cc1cc(C)n(CC2CCCN2CC2(O)CCCCC2)n1.
What is the InChIKey of 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol?
The InChIKey is XTVJCVGFMGHEIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O/c1-14-11-15(2)20(18-14)12-16-7-6-10-19(16)13-17(21)8-4-3-5-9-17/h11,16,21H,3-10,12-13H2,1-2H3.
What are the key properties of 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol?
1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol has a molecular weight of 291.44 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]cyclohexan-1-ol is sourced from PubChem (CID 56780851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).