C17H22N4O — CID 56780965
(E)-3-(2-methoxyphenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ylmethyl)prop-2-en-1-amine (PubChem CID 56780965) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ylmethyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(2-methoxyphenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 56780965 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ylmethyl)prop-2-en-1-amine |
| SMILES | COc1ccccc1/C=C/CNCC1CCc2nncn2C1 |
| InChI | InChI=1S/C17H22N4O/c1-22-16-7-3-2-5-15(16)6-4-10-18-11-14-8-9-17-20-19-13-21(17)12-14/h2-7,13-14,18H,8-12H2,1H3/b6-4+ |
| InChIKey | DSCAZJLSJSATMG-GQCTYLIASA-N |
| XLogP | 2.15 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|