C15H24N4O — CID 56781035
1-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2-methylprop-2-enyl)piperidin-3-amine (PubChem CID 56781035) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2-methylprop-2-enyl)piperidin-3-amine.
| Compound Name | 1-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2-methylprop-2-enyl)piperidin-3-amine |
|---|---|
| PubChem CID | 56781035 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2-methylprop-2-enyl)piperidin-3-amine |
| SMILES | C=C(C)CNC1CCCN(Cc2noc(C3CC3)n2)C1 |
| InChI | InChI=1S/C15H24N4O/c1-11(2)8-16-13-4-3-7-19(9-13)10-14-17-15(20-18-14)12-5-6-12/h12-13,16H,1,3-10H2,2H3 |
| InChIKey | GGNIXJYXKJJVNS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|