C15H22N4OS — CID 56781060
2-[2-(4-methylpyrazol-1-yl)ethylamino]-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 56781060) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 2-[2-(4-methylpyrazol-1-yl)ethylamino]-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | 2-[2-(4-methylpyrazol-1-yl)ethylamino]-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 56781060 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[2-(4-methylpyrazol-1-yl)ethylamino]-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | Cc1cnn(CCNC(C)C(=O)NCCc2cccs2)c1 |
| InChI | InChI=1S/C15H22N4OS/c1-12-10-18-19(11-12)8-7-16-13(2)15(20)17-6-5-14-4-3-9-21-14/h3-4,9-11,13,16H,5-8H2,1-2H3,(H,17,20) |
| InChIKey | XJUINPVMFVHMDN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |