About 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine
2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine (PubChem CID 56781090) has the molecular formula C17H24N4
and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine.
Molecular Properties
| Compound Name | 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine |
| PubChem CID | 56781090 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine |
| SMILES | Cc1cc(C)n(CC2CCCN2CCc2ccccn2)n1 |
| InChI | InChI=1S/C17H24N4/c1-14-12-15(2)21(19-14)13-17-7-5-10-20(17)11-8-16-6-3-4-9-18-16/h3-4,6,9,12,17H,5,7-8,10-11,13H2,1-2H3 |
| InChIKey | IESRYGRUBDHULQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine?
The IUPAC name of 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine (CID 56781090) is 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine.
What is the SMILES notation for 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine?
The canonical SMILES for 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine is Cc1cc(C)n(CC2CCCN2CCc2ccccn2)n1.
What is the InChIKey of 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine?
The InChIKey is IESRYGRUBDHULQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4/c1-14-12-15(2)21(19-14)13-17-7-5-10-20(17)11-8-16-6-3-4-9-18-16/h3-4,6,9,12,17H,5,7-8,10-11,13H2,1-2H3.
What are the key properties of 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine?
2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine has a molecular weight of 284.41 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]ethyl]pyridine is sourced from PubChem (CID 56781090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).