About N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine
N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine (PubChem CID 56781260) has the molecular formula C12H19N5O
and a molecular weight of 249.32 g/mol. Its IUPAC name is N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine.
Molecular Properties
| Compound Name | N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine |
| PubChem CID | 56781260 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine |
| SMILES | CCCCc1nc(CNCCn2cccn2)no1 |
| InChI | InChI=1S/C12H19N5O/c1-2-3-5-12-15-11(16-18-12)10-13-7-9-17-8-4-6-14-17/h4,6,8,13H,2-3,5,7,9-10H2,1H3 |
| InChIKey | VWBZEIJANHMHLU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine?
The IUPAC name of N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine (CID 56781260) is N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine.
What is the SMILES notation for N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine?
The canonical SMILES for N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine is CCCCc1nc(CNCCn2cccn2)no1.
What is the InChIKey of N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine?
The InChIKey is VWBZEIJANHMHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5O/c1-2-3-5-12-15-11(16-18-12)10-13-7-9-17-8-4-6-14-17/h4,6,8,13H,2-3,5,7,9-10H2,1H3.
What are the key properties of N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine?
N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine has a molecular weight of 249.32 g/mol, XLogP of 1.40, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazol-1-ylethanamine is sourced from PubChem (CID 56781260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).