C17H22N8 — CID 56781309
N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 56781309) has the molecular formula C17H22N8 and a molecular weight of 338.42 g/mol. Its IUPAC name is N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 56781309 |
| Molecular Formula | C17H22N8 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2n(n1)CC(NCc1nnnn1-c1c(C)cccc1C)CC2 |
| InChI | InChI=1S/C17H22N8/c1-11-5-4-6-12(2)17(11)25-16(20-22-23-25)9-18-14-7-8-15-19-13(3)21-24(15)10-14/h4-6,14,18H,7-10H2,1-3H3 |
| InChIKey | HJHSPFBSLHXZMV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |