About 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide
4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 56782601) has the molecular formula C12H15BrN4O2
and a molecular weight of 327.18 g/mol. Its IUPAC name is 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| PubChem CID | 56782601 |
| Molecular Formula | C12H15BrN4O2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1noc(C)c1NC(=O)c1n[nH]c(C(C)C)c1Br |
| InChI | InChI=1S/C12H15BrN4O2/c1-5(2)9-8(13)11(16-15-9)12(18)14-10-6(3)17-19-7(10)4/h5H,1-4H3,(H,14,18)(H,15,16) |
| InChIKey | ZKZSMUYPTOUAAP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide?
The IUPAC name of 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide (CID 56782601) is 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide?
The canonical SMILES for 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide is Cc1noc(C)c1NC(=O)c1n[nH]c(C(C)C)c1Br.
What is the InChIKey of 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide?
The InChIKey is ZKZSMUYPTOUAAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN4O2/c1-5(2)9-8(13)11(16-15-9)12(18)14-10-6(3)17-19-7(10)4/h5H,1-4H3,(H,14,18)(H,15,16).
What are the key properties of 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide?
4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide has a molecular weight of 327.18 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 56782601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).