C14H15F2N3O3 — CID 56782644
1-[2-(2,4-difluorophenoxy)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea (PubChem CID 56782644) has the molecular formula C14H15F2N3O3 and a molecular weight of 311.29 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea |
|---|---|
| PubChem CID | 56782644 |
| Molecular Formula | C14H15F2N3O3 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea |
| SMILES | Cc1noc(C)c1NC(=O)NCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C14H15F2N3O3/c1-8-13(9(2)22-19-8)18-14(20)17-5-6-21-12-4-3-10(15)7-11(12)16/h3-4,7H,5-6H2,1-2H3,(H2,17,18,20) |
| InChIKey | IRFKAMISANGPNQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|