About 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one
3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one (PubChem CID 56782754) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one |
| PubChem CID | 56782754 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cc(OCCCN2CCOC2=O)nnc1C |
| InChI | InChI=1S/C12H17N3O3/c1-9-8-11(14-13-10(9)2)17-6-3-4-15-5-7-18-12(15)16/h8H,3-7H2,1-2H3 |
| InChIKey | KLJGDDZJAAOPSY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one (CID 56782754) is 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one is Cc1cc(OCCCN2CCOC2=O)nnc1C.
What is the InChIKey of 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one?
The InChIKey is KLJGDDZJAAOPSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-9-8-11(14-13-10(9)2)17-6-3-4-15-5-7-18-12(15)16/h8H,3-7H2,1-2H3.
What are the key properties of 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one?
3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one has a molecular weight of 251.29 g/mol, XLogP of 1.31, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(5,6-dimethylpyridazin-3-yl)oxypropyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 56782754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).