C12H16ClNO3S2 — CID 56782791
N-[(4-chlorophenyl)methyl]-2-(2-methylsulfonylethylsulfanyl)acetamide (PubChem CID 56782791) has the molecular formula C12H16ClNO3S2 and a molecular weight of 321.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(2-methylsulfonylethylsulfanyl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(2-methylsulfonylethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 56782791 |
| Molecular Formula | C12H16ClNO3S2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(2-methylsulfonylethylsulfanyl)acetamide |
| SMILES | CS(=O)(=O)CCSCC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO3S2/c1-19(16,17)7-6-18-9-12(15)14-8-10-2-4-11(13)5-3-10/h2-5H,6-9H2,1H3,(H,14,15) |
| InChIKey | GSYHMNYIWSVUSH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|