About tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate
tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate (PubChem CID 56783013) has the molecular formula C15H23N3O3S
and a molecular weight of 325.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate |
| PubChem CID | 56783013 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)NCc1nccs1 |
| InChI | InChI=1S/C15H23N3O3S/c1-15(2,3)21-14(20)18-8-5-4-6-11(18)13(19)17-10-12-16-7-9-22-12/h7,9,11H,4-6,8,10H2,1-3H3,(H,17,19)/t11-/m0/s1 |
| InChIKey | IGFFSBZYJWYBDS-NSHDSACASA-N |
| XLogP | 2.55 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate (CID 56783013) is tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)NCc1nccs1.
What is the InChIKey of tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate?
The InChIKey is IGFFSBZYJWYBDS-NSHDSACASA-N. The full InChI is InChI=1S/C15H23N3O3S/c1-15(2,3)21-14(20)18-8-5-4-6-11(18)13(19)17-10-12-16-7-9-22-12/h7,9,11H,4-6,8,10H2,1-3H3,(H,17,19)/t11-/m0/s1.
What are the key properties of tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate?
tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate has a molecular weight of 325.43 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-(1,3-thiazol-2-ylmethylcarbamoyl)piperidine-1-carboxylate is sourced from PubChem (CID 56783013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).