About 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea
3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea (PubChem CID 56783168) has the molecular formula C17H27N5OS
and a molecular weight of 349.50 g/mol. Its IUPAC name is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea.
Molecular Properties
| Compound Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea |
| PubChem CID | 56783168 |
| Molecular Formula | C17H27N5OS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea |
| SMILES | CCCN(Cc1cnn(C)c1)C(=O)NCc1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C17H27N5OS/c1-6-7-22(11-13-8-19-21(5)10-13)16(23)18-9-14-12-24-15(20-14)17(2,3)4/h8,10,12H,6-7,9,11H2,1-5H3,(H,18,23) |
| InChIKey | HUFHHVFAUKAKBZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea?
The IUPAC name of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea (CID 56783168) is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea.
What is the SMILES notation for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea?
The canonical SMILES for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea is CCCN(Cc1cnn(C)c1)C(=O)NCc1csc(C(C)(C)C)n1.
What is the InChIKey of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea?
The InChIKey is HUFHHVFAUKAKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N5OS/c1-6-7-22(11-13-8-19-21(5)10-13)16(23)18-9-14-12-24-15(20-14)17(2,3)4/h8,10,12H,6-7,9,11H2,1-5H3,(H,18,23).
What are the key properties of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea?
3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea has a molecular weight of 349.50 g/mol, XLogP of 3.30, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]-1-propylurea is sourced from PubChem (CID 56783168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).