C20H34N4O — CID 56783509
[3-(azepan-1-yl)piperidin-1-yl]-(1-tert-butyl-5-methylpyrazol-3-yl)methanone (PubChem CID 56783509) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is [3-(azepan-1-yl)piperidin-1-yl]-(1-tert-butyl-5-methylpyrazol-3-yl)methanone.
| Compound Name | [3-(azepan-1-yl)piperidin-1-yl]-(1-tert-butyl-5-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 56783509 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | [3-(azepan-1-yl)piperidin-1-yl]-(1-tert-butyl-5-methylpyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCC(N3CCCCCC3)C2)nn1C(C)(C)C |
| InChI | InChI=1S/C20H34N4O/c1-16-14-18(21-24(16)20(2,3)4)19(25)23-13-9-10-17(15-23)22-11-7-5-6-8-12-22/h14,17H,5-13,15H2,1-4H3 |
| InChIKey | XBJWQCPZRJMQPN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |