C10H13F3N2O2S2 — CID 56785090
N-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]ethanesulfonamide (PubChem CID 56785090) has the molecular formula C10H13F3N2O2S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is N-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]ethanesulfonamide.
| Compound Name | N-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 56785090 |
| Molecular Formula | C10H13F3N2O2S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | N-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCSc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H13F3N2O2S2/c1-2-19(16,17)15-5-6-18-9-4-3-8(7-14-9)10(11,12)13/h3-4,7,15H,2,5-6H2,1H3 |
| InChIKey | CVEJRWRBSXOETF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|