C8H10F3N3O4 — CID 56785140
2,2,2-trifluoroethyl N-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]ethyl]carbamate (PubChem CID 56785140) has the molecular formula C8H10F3N3O4 and a molecular weight of 269.18 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 56785140 |
| Molecular Formula | C8H10F3N3O4 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]ethyl]carbamate |
| SMILES | Cc1noc(OCCNC(=O)OCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3N3O4/c1-5-13-7(18-14-5)16-3-2-12-6(15)17-4-8(9,10)11/h2-4H2,1H3,(H,12,15) |
| InChIKey | BYDQIOGYFWJMCZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|