About N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide
N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide (PubChem CID 56785456) has the molecular formula C16H17N3OS
and a molecular weight of 299.40 g/mol. Its IUPAC name is N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide.
Molecular Properties
| Compound Name | N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide |
| PubChem CID | 56785456 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide |
| SMILES | Cc1ccc(CC(=O)NCc2cn3c(C)cccc3n2)s1 |
| InChI | InChI=1S/C16H17N3OS/c1-11-4-3-5-15-18-13(10-19(11)15)9-17-16(20)8-14-7-6-12(2)21-14/h3-7,10H,8-9H2,1-2H3,(H,17,20) |
| InChIKey | SJABVNVOEVTSAP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide?
The IUPAC name of N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide (CID 56785456) is N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide.
What is the SMILES notation for N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide?
The canonical SMILES for N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide is Cc1ccc(CC(=O)NCc2cn3c(C)cccc3n2)s1.
What is the InChIKey of N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide?
The InChIKey is SJABVNVOEVTSAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3OS/c1-11-4-3-5-15-18-13(10-19(11)15)9-17-16(20)8-14-7-6-12(2)21-14/h3-7,10H,8-9H2,1-2H3,(H,17,20).
What are the key properties of N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide?
N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide has a molecular weight of 299.40 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-(5-methylthiophen-2-yl)acetamide is sourced from PubChem (CID 56785456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).