C10H13F3N2O4 — CID 56785732
2-(2,2,2-trifluoroethoxy)ethyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate (PubChem CID 56785732) has the molecular formula C10H13F3N2O4 and a molecular weight of 282.22 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)ethyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | 2-(2,2,2-trifluoroethoxy)ethyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 56785732 |
| Molecular Formula | C10H13F3N2O4 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)ethyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate |
| SMILES | CN1N=C(C(=O)OCCOCC(F)(F)F)CCC1=O |
| InChI | InChI=1S/C10H13F3N2O4/c1-15-8(16)3-2-7(14-15)9(17)19-5-4-18-6-10(11,12)13/h2-6H2,1H3 |
| InChIKey | XIEFLIKUHGQHEG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|