About 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile
2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile (PubChem CID 56786278) has the molecular formula C18H28N4O
and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile.
Molecular Properties
| Compound Name | 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile |
| PubChem CID | 56786278 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile |
| SMILES | COc1c(C)cnc(CN2CCN(C(C#N)C(C)C)CC2)c1C |
| InChI | InChI=1S/C18H28N4O/c1-13(2)17(10-19)22-8-6-21(7-9-22)12-16-15(4)18(23-5)14(3)11-20-16/h11,13,17H,6-9,12H2,1-5H3 |
| InChIKey | LJCVPSHZMJSHGJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile?
The IUPAC name of 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile (CID 56786278) is 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile.
What is the SMILES notation for 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile?
The canonical SMILES for 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile is COc1c(C)cnc(CN2CCN(C(C#N)C(C)C)CC2)c1C.
What is the InChIKey of 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile?
The InChIKey is LJCVPSHZMJSHGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O/c1-13(2)17(10-19)22-8-6-21(7-9-22)12-16-15(4)18(23-5)14(3)11-20-16/h11,13,17H,6-9,12H2,1-5H3.
What are the key properties of 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile?
2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile has a molecular weight of 316.45 g/mol, XLogP of 2.37, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]piperazin-1-yl]-3-methylbutanenitrile is sourced from PubChem (CID 56786278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).