About N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide
N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide (PubChem CID 56788116) has the molecular formula C16H14F2N4OS
and a molecular weight of 348.38 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 56788116 |
| Molecular Formula | C16H14F2N4OS |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CN(Cc1ccc(F)c(F)c1)C(=O)c1cnc(-c2cnn(C)c2)s1 |
| InChI | InChI=1S/C16H14F2N4OS/c1-21(8-10-3-4-12(17)13(18)5-10)16(23)14-7-19-15(24-14)11-6-20-22(2)9-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | GKVYMNWJBHXKJL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide (CID 56788116) is N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide is CN(Cc1ccc(F)c(F)c1)C(=O)c1cnc(-c2cnn(C)c2)s1.
What is the InChIKey of N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide?
The InChIKey is GKVYMNWJBHXKJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2N4OS/c1-21(8-10-3-4-12(17)13(18)5-10)16(23)14-7-19-15(24-14)11-6-20-22(2)9-11/h3-7,9H,8H2,1-2H3.
What are the key properties of N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide?
N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide has a molecular weight of 348.38 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-difluorophenyl)methyl]-N-methyl-2-(1-methylpyrazol-4-yl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 56788116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).