C10H13F7N2O2 — CID 567883
2,2,3,3,4,4,4-heptafluoro-N-(2-morpholin-4-ylethyl)butanamide (PubChem CID 567883) has the molecular formula C10H13F7N2O2 and a molecular weight of 326.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(2-morpholin-4-ylethyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-morpholin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 567883 |
| Molecular Formula | C10H13F7N2O2 |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-morpholin-4-ylethyl)butanamide |
| SMILES | O=C(NCCN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F7N2O2/c11-8(12,9(13,14)10(15,16)17)7(20)18-1-2-19-3-5-21-6-4-19/h1-6H2,(H,18,20) |
| InChIKey | YIKDGYMMXNUBDA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|