About (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone
(6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone (PubChem CID 56788362) has the molecular formula C15H14BrN3O
and a molecular weight of 332.20 g/mol. Its IUPAC name is (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone.
Molecular Properties
| Compound Name | (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone |
| PubChem CID | 56788362 |
| Molecular Formula | C15H14BrN3O |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone |
| SMILES | CCc1ncncc1C(=O)N1CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H14BrN3O/c1-2-13-12(8-17-9-18-13)15(20)19-6-5-10-3-4-11(16)7-14(10)19/h3-4,7-9H,2,5-6H2,1H3 |
| InChIKey | VTHYMUVNQIQQFY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone?
The IUPAC name of (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone (CID 56788362) is (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone.
What is the SMILES notation for (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone?
The canonical SMILES for (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone is CCc1ncncc1C(=O)N1CCc2ccc(Br)cc21.
What is the InChIKey of (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone?
The InChIKey is VTHYMUVNQIQQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrN3O/c1-2-13-12(8-17-9-18-13)15(20)19-6-5-10-3-4-11(16)7-14(10)19/h3-4,7-9H,2,5-6H2,1H3.
What are the key properties of (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone?
(6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone has a molecular weight of 332.20 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2,3-dihydroindol-1-yl)-(4-ethylpyrimidin-5-yl)methanone is sourced from PubChem (CID 56788362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).