About pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone
pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone (PubChem CID 56789032) has the molecular formula C18H18F3N3O
and a molecular weight of 349.36 g/mol. Its IUPAC name is pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone |
| PubChem CID | 56789032 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccn1)N1CCN(C(c2ccccc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H18F3N3O/c19-18(20,21)16(14-6-2-1-3-7-14)23-10-12-24(13-11-23)17(25)15-8-4-5-9-22-15/h1-9,16H,10-13H2 |
| InChIKey | SNYYBLCZMADOQV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone?
The IUPAC name of pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone (CID 56789032) is pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone.
What is the SMILES notation for pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone?
The canonical SMILES for pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone is O=C(c1ccccn1)N1CCN(C(c2ccccc2)C(F)(F)F)CC1.
What is the InChIKey of pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone?
The InChIKey is SNYYBLCZMADOQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F3N3O/c19-18(20,21)16(14-6-2-1-3-7-14)23-10-12-24(13-11-23)17(25)15-8-4-5-9-22-15/h1-9,16H,10-13H2.
What are the key properties of pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone?
pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone has a molecular weight of 349.36 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl-[4-(2,2,2-trifluoro-1-phenylethyl)piperazin-1-yl]methanone is sourced from PubChem (CID 56789032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).