About 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one
4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one (PubChem CID 56789095) has the molecular formula C12H15BrN4OS
and a molecular weight of 343.25 g/mol. Its IUPAC name is 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one |
| PubChem CID | 56789095 |
| Molecular Formula | C12H15BrN4OS |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one |
| SMILES | CCc1nc(CN(C)c2cnn(C)c(=O)c2Br)cs1 |
| InChI | InChI=1S/C12H15BrN4OS/c1-4-10-15-8(7-19-10)6-16(2)9-5-14-17(3)12(18)11(9)13/h5,7H,4,6H2,1-3H3 |
| InChIKey | YJVBHFDEEGNPOB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one?
The IUPAC name of 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one (CID 56789095) is 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one.
What is the SMILES notation for 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one?
The canonical SMILES for 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one is CCc1nc(CN(C)c2cnn(C)c(=O)c2Br)cs1.
What is the InChIKey of 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one?
The InChIKey is YJVBHFDEEGNPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN4OS/c1-4-10-15-8(7-19-10)6-16(2)9-5-14-17(3)12(18)11(9)13/h5,7H,4,6H2,1-3H3.
What are the key properties of 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one?
4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one has a molecular weight of 343.25 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-[(2-ethyl-1,3-thiazol-4-yl)methyl-methylamino]-2-methylpyridazin-3-one is sourced from PubChem (CID 56789095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).