About N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide
N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide (PubChem CID 56789220) has the molecular formula C16H16N2O3S2
and a molecular weight of 348.45 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide.
Molecular Properties
| Compound Name | N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide |
| PubChem CID | 56789220 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(C)(C(=O)Nc1nc2c(ccc3ccccc32)s1)S(C)(=O)=O |
| InChI | InChI=1S/C16H16N2O3S2/c1-16(2,23(3,20)21)14(19)18-15-17-13-11-7-5-4-6-10(11)8-9-12(13)22-15/h4-9H,1-3H3,(H,17,18,19) |
| InChIKey | GOSWYDQHEFIBLS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide?
The IUPAC name of N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide (CID 56789220) is N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide.
What is the SMILES notation for N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide?
The canonical SMILES for N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide is CC(C)(C(=O)Nc1nc2c(ccc3ccccc32)s1)S(C)(=O)=O.
What is the InChIKey of N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide?
The InChIKey is GOSWYDQHEFIBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3S2/c1-16(2,23(3,20)21)14(19)18-15-17-13-11-7-5-4-6-10(11)8-9-12(13)22-15/h4-9H,1-3H3,(H,17,18,19).
What are the key properties of N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide?
N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide has a molecular weight of 348.45 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzo[e][1,3]benzothiazol-2-yl-2-methyl-2-methylsulfonylpropanamide is sourced from PubChem (CID 56789220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).