C14H20F3N3OS — CID 56789817
N-[1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]-3-(2,2,2-trifluoroethylamino)propanamide (PubChem CID 56789817) has the molecular formula C14H20F3N3OS and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]-3-(2,2,2-trifluoroethylamino)propanamide.
| Compound Name | N-[1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]-3-(2,2,2-trifluoroethylamino)propanamide |
|---|---|
| PubChem CID | 56789817 |
| Molecular Formula | C14H20F3N3OS |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]-3-(2,2,2-trifluoroethylamino)propanamide |
| SMILES | CC(NC(=O)CCNCC(F)(F)F)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H20F3N3OS/c1-9(13-20-10-4-2-3-5-11(10)22-13)19-12(21)6-7-18-8-14(15,16)17/h9,18H,2-8H2,1H3,(H,19,21) |
| InChIKey | ZFRHJLXZWLTNJD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|