About 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione
1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione (PubChem CID 56790255) has the molecular formula C16H15N5O4
and a molecular weight of 341.33 g/mol. Its IUPAC name is 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione |
| PubChem CID | 56790255 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione |
| SMILES | Cc1cc(C)n(-c2ccc(Cn3cc([N+](=O)[O-])c(=O)[nH]c3=O)cc2)n1 |
| InChI | InChI=1S/C16H15N5O4/c1-10-7-11(2)20(18-10)13-5-3-12(4-6-13)8-19-9-14(21(24)25)15(22)17-16(19)23/h3-7,9H,8H2,1-2H3,(H,17,22,23) |
| InChIKey | IDABJQJVRXEGCG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione?
The IUPAC name of 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione (CID 56790255) is 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione.
What is the SMILES notation for 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione?
The canonical SMILES for 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione is Cc1cc(C)n(-c2ccc(Cn3cc([N+](=O)[O-])c(=O)[nH]c3=O)cc2)n1.
What is the InChIKey of 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione?
The InChIKey is IDABJQJVRXEGCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O4/c1-10-7-11(2)20(18-10)13-5-3-12(4-6-13)8-19-9-14(21(24)25)15(22)17-16(19)23/h3-7,9H,8H2,1-2H3,(H,17,22,23).
What are the key properties of 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione?
1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione has a molecular weight of 341.33 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-dione is sourced from PubChem (CID 56790255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).