C12H13N7O2 — CID 56790398
N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine (PubChem CID 56790398) has the molecular formula C12H13N7O2 and a molecular weight of 287.28 g/mol. Its IUPAC name is N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine.
| Compound Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 56790398 |
| Molecular Formula | C12H13N7O2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-nitroimidazo[1,2-a]pyridin-2-amine |
| SMILES | Cn1cnnc1CCNc1nc2ccccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N7O2/c1-17-8-14-16-10(17)5-6-13-11-12(19(20)21)18-7-3-2-4-9(18)15-11/h2-4,7-8,13H,5-6H2,1H3 |
| InChIKey | SIJGMCQGIJKFGB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|