About 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole
1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole (PubChem CID 56790425) has the molecular formula C8H13N7
and a molecular weight of 207.24 g/mol. Its IUPAC name is 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole.
Molecular Properties
| Compound Name | 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole |
| PubChem CID | 56790425 |
| Molecular Formula | C8H13N7 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole |
| SMILES | CCCCn1nnnc1Cn1cncn1 |
| InChI | InChI=1S/C8H13N7/c1-2-3-4-15-8(11-12-13-15)5-14-7-9-6-10-14/h6-7H,2-5H2,1H3 |
| InChIKey | IWJXQNPLIZDTDT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole?
The IUPAC name of 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole (CID 56790425) is 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole.
What is the SMILES notation for 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole?
The canonical SMILES for 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole is CCCCn1nnnc1Cn1cncn1.
What is the InChIKey of 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole?
The InChIKey is IWJXQNPLIZDTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N7/c1-2-3-4-15-8(11-12-13-15)5-14-7-9-6-10-14/h6-7H,2-5H2,1H3.
What are the key properties of 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole?
1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole has a molecular weight of 207.24 g/mol, XLogP of 0.11, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-(1,2,4-triazol-1-ylmethyl)tetrazole is sourced from PubChem (CID 56790425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).