C13H14BrN5O — CID 56790493
2-[5-[(4-bromophenyl)methyl]tetrazol-1-yl]-N-prop-2-enylacetamide (PubChem CID 56790493) has the molecular formula C13H14BrN5O and a molecular weight of 336.19 g/mol. Its IUPAC name is 2-[5-[(4-bromophenyl)methyl]tetrazol-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[5-[(4-bromophenyl)methyl]tetrazol-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 56790493 |
| Molecular Formula | C13H14BrN5O |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-[5-[(4-bromophenyl)methyl]tetrazol-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cn1nnnc1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14BrN5O/c1-2-7-15-13(20)9-19-12(16-17-18-19)8-10-3-5-11(14)6-4-10/h2-6H,1,7-9H2,(H,15,20) |
| InChIKey | UIEFUHDYCWOVKR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|