C19H21N3OS — CID 56791675
3-(1H-benzimidazol-2-yl)-N-[2-methyl-3-(methylsulfanylmethyl)phenyl]propanamide (PubChem CID 56791675) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[2-methyl-3-(methylsulfanylmethyl)phenyl]propanamide.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[2-methyl-3-(methylsulfanylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 56791675 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[2-methyl-3-(methylsulfanylmethyl)phenyl]propanamide |
| SMILES | CSCc1cccc(NC(=O)CCc2nc3ccccc3[nH]2)c1C |
| InChI | InChI=1S/C19H21N3OS/c1-13-14(12-24-2)6-5-9-15(13)22-19(23)11-10-18-20-16-7-3-4-8-17(16)21-18/h3-9H,10-12H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | QDABUXWUFWJFTB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |