C14H17NO2S2 — CID 56791791
N-(2-phenyl-1-thiophen-2-ylethyl)ethanesulfonamide (PubChem CID 56791791) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is N-(2-phenyl-1-thiophen-2-ylethyl)ethanesulfonamide.
| Compound Name | N-(2-phenyl-1-thiophen-2-ylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 56791791 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-(2-phenyl-1-thiophen-2-ylethyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC(Cc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C14H17NO2S2/c1-2-19(16,17)15-13(14-9-6-10-18-14)11-12-7-4-3-5-8-12/h3-10,13,15H,2,11H2,1H3 |
| InChIKey | JUGXYEYCQGSOPT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |