About 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one
3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 56791936) has the molecular formula C12H10F6N2O2
and a molecular weight of 328.21 g/mol. Its IUPAC name is 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one |
| PubChem CID | 56791936 |
| Molecular Formula | C12H10F6N2O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1ccc[nH]c1=O)N1CCC(C(F)(F)F)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H10F6N2O2/c13-11(14,15)10(12(16,17)18)3-5-20(6-10)9(22)7-2-1-4-19-8(7)21/h1-2,4H,3,5-6H2,(H,19,21) |
| InChIKey | OPQPTZRHFFEUGR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one?
The IUPAC name of 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one (CID 56791936) is 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one.
What is the SMILES notation for 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one?
The canonical SMILES for 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one is O=C(c1ccc[nH]c1=O)N1CCC(C(F)(F)F)(C(F)(F)F)C1.
What is the InChIKey of 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one?
The InChIKey is OPQPTZRHFFEUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F6N2O2/c13-11(14,15)10(12(16,17)18)3-5-20(6-10)9(22)7-2-1-4-19-8(7)21/h1-2,4H,3,5-6H2,(H,19,21).
What are the key properties of 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one?
3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one has a molecular weight of 328.21 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-bis(trifluoromethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one is sourced from PubChem (CID 56791936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).