About N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide
N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide (PubChem CID 56791953) has the molecular formula C10H16F6N2O2S
and a molecular weight of 342.31 g/mol. Its IUPAC name is N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide |
| PubChem CID | 56791953 |
| Molecular Formula | C10H16F6N2O2S |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCN1CCC(C(F)(F)F)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H16F6N2O2S/c1-2-21(19,20)17-4-6-18-5-3-8(7-18,9(11,12)13)10(14,15)16/h17H,2-7H2,1H3 |
| InChIKey | ORFHVLRFYHJPLD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide?
The IUPAC name of N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide (CID 56791953) is N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide.
What is the SMILES notation for N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide?
The canonical SMILES for N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide is CCS(=O)(=O)NCCN1CCC(C(F)(F)F)(C(F)(F)F)C1.
What is the InChIKey of N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide?
The InChIKey is ORFHVLRFYHJPLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F6N2O2S/c1-2-21(19,20)17-4-6-18-5-3-8(7-18,9(11,12)13)10(14,15)16/h17H,2-7H2,1H3.
What are the key properties of N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide?
N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide has a molecular weight of 342.31 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]ethyl]ethanesulfonamide is sourced from PubChem (CID 56791953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).