C14H16N2O3S2 — CID 56791969
2-methyl-4-(4-thiomorpholin-4-ylsulfonylphenyl)-1,3-oxazole (PubChem CID 56791969) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-methyl-4-(4-thiomorpholin-4-ylsulfonylphenyl)-1,3-oxazole.
| Compound Name | 2-methyl-4-(4-thiomorpholin-4-ylsulfonylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 56791969 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-methyl-4-(4-thiomorpholin-4-ylsulfonylphenyl)-1,3-oxazole |
| SMILES | Cc1nc(-c2ccc(S(=O)(=O)N3CCSCC3)cc2)co1 |
| InChI | InChI=1S/C14H16N2O3S2/c1-11-15-14(10-19-11)12-2-4-13(5-3-12)21(17,18)16-6-8-20-9-7-16/h2-5,10H,6-9H2,1H3 |
| InChIKey | QWASTKORXWLTGG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |