About N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide (PubChem CID 56792515) has the molecular formula C17H26N2O3S
and a molecular weight of 338.47 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide |
| PubChem CID | 56792515 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide |
| SMILES | CC(C)(CNS(=O)(=O)C1CCOC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2,13-18-23(20,21)16-8-10-22-12-16)19-9-7-14-5-3-4-6-15(14)11-19/h3-6,16,18H,7-13H2,1-2H3 |
| InChIKey | WFUCQTPNPATLRD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide?
The IUPAC name of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide (CID 56792515) is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide.
What is the SMILES notation for N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide?
The canonical SMILES for N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide is CC(C)(CNS(=O)(=O)C1CCOC1)N1CCc2ccccc2C1.
What is the InChIKey of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide?
The InChIKey is WFUCQTPNPATLRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3S/c1-17(2,13-18-23(20,21)16-8-10-22-12-16)19-9-7-14-5-3-4-6-15(14)11-19/h3-6,16,18H,7-13H2,1-2H3.
What are the key properties of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide?
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide has a molecular weight of 338.47 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]oxolane-3-sulfonamide is sourced from PubChem (CID 56792515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).