C18H21N3O2S — CID 56792579
N-(3-phenyl-1,2-thiazol-5-yl)-1-propanoylpiperidine-3-carboxamide (PubChem CID 56792579) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-(3-phenyl-1,2-thiazol-5-yl)-1-propanoylpiperidine-3-carboxamide.
| Compound Name | N-(3-phenyl-1,2-thiazol-5-yl)-1-propanoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 56792579 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(3-phenyl-1,2-thiazol-5-yl)-1-propanoylpiperidine-3-carboxamide |
| SMILES | CCC(=O)N1CCCC(C(=O)Nc2cc(-c3ccccc3)ns2)C1 |
| InChI | InChI=1S/C18H21N3O2S/c1-2-17(22)21-10-6-9-14(12-21)18(23)19-16-11-15(20-24-16)13-7-4-3-5-8-13/h3-5,7-8,11,14H,2,6,9-10,12H2,1H3,(H,19,23) |
| InChIKey | OYUAZOSNPWVBIX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |