C16H14ClN3O3 — CID 56792709
4-[(3-chloro-5-cyano-2-pyridinyl)oxy]-N-(2-hydroxyethyl)-N-methylbenzamide (PubChem CID 56792709) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is 4-[(3-chloro-5-cyano-2-pyridinyl)oxy]-N-(2-hydroxyethyl)-N-methylbenzamide.
| Compound Name | 4-[(3-chloro-5-cyano-2-pyridinyl)oxy]-N-(2-hydroxyethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 56792709 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 4-[(3-chloro-5-cyano-2-pyridinyl)oxy]-N-(2-hydroxyethyl)-N-methylbenzamide |
| SMILES | CN(CCO)C(=O)c1ccc(Oc2ncc(C#N)cc2Cl)cc1 |
| InChI | InChI=1S/C16H14ClN3O3/c1-20(6-7-21)16(22)12-2-4-13(5-3-12)23-15-14(17)8-11(9-18)10-19-15/h2-5,8,10,21H,6-7H2,1H3 |
| InChIKey | TYOWSRCCSOHHMK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |